CAS 1704063-76-2 is the registry number for 2–(Pyrrolidin–1–yl)–5–(trifluoromethyl)phenylboronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]boronic acid (CAS 1704063-76-2) is a chemical compound with the molecular formula C11H13BF3NO2 and a molecular weight of 259.03 g/mol. IUPAC name: [2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: SORAIKKCUJHDRD-UHFFFAOYSA-N.
| Molecular formula | C11H13BF3NO2 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | [2-pyrrolidin-1-yl-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | SORAIKKCUJHDRD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)N2CCCC2)(O)O |
Computed by PubChem (NCBI)