Products 2256708-86-6
CAS 2256708-86-6 is the registry number for (4–(pyrrolidin–3–yl)–3–(trifluoromethyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
[4-pyrrolidin-3-yl-3-(trifluoromethyl)phenyl]boronic acid (CAS 2256708-86-6) is a chemical compound with the molecular formula C11H13BF3NO2 and a molecular weight of 259.03 g/mol. IUPAC name: [4-pyrrolidin-3-yl-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: FJZKTXHZEKRFSJ-UHFFFAOYSA-N.
| Molecular formula | C11H13BF3NO2 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | [4-pyrrolidin-3-yl-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | FJZKTXHZEKRFSJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C2CCNC2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)