CAS 2225178-40-3 appears in our catalog under these names: 2-Trifluoromethyl-4-(pyrrolidino)phenylboronic acid, 95%, 2–Trifluoromethyl–4–(pyrrolidino)phenylboronic acid, 2-Trifluoromethyl-4-(pyrrolidino)phenylboronic acid. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 5g, 25mg, 250mg.
[4-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]boronic acid (CAS 2225178-40-3) is a chemical compound with the molecular formula C11H13BF3NO2 and a molecular weight of 259.03 g/mol. IUPAC name: [4-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: XSXLFVHKNVNTMO-UHFFFAOYSA-N.
| Molecular formula | C11H13BF3NO2 |
|---|---|
| Molecular weight | 259.03 g/mol |
| IUPAC name | [4-pyrrolidin-1-yl-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | XSXLFVHKNVNTMO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)N2CCCC2)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)