Products 1704063-80-8
CAS 1704063-80-8 appears in our catalog under these names: 2–(Dimethylamino)–5–(trifluoromethyl)phenylboronic acid, Boronic acid, B-[2-(dimethylamino)-5-(trifluoromethyl)phenyl]-, 98%, 98%, (2-(DIMETHYLAMINO)-5-(TRIFLUOROMETHYL)PHENYL)BORONIC ACID, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, 1g.
[2-(dimethylamino)-5-(trifluoromethyl)phenyl]boronic acid (CAS 1704063-80-8) is a chemical compound with the molecular formula C9H11BF3NO2 and a molecular weight of 233.00 g/mol. IUPAC name: [2-(dimethylamino)-5-(trifluoromethyl)phenyl]boronic acid. InChIKey: WZXRLKLDBYCSGQ-UHFFFAOYSA-N.
| Molecular formula | C9H11BF3NO2 |
|---|---|
| Molecular weight | 233.00 g/mol |
| IUPAC name | [2-(dimethylamino)-5-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | WZXRLKLDBYCSGQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(F)(F)F)N(C)C)(O)O |
Computed by PubChem (NCBI)