Products 2225170-66-9
CAS 2225170-66-9 is the registry number for 2–(n–Propyl–d7)–6–trifluoromethylpyridine–4–boronic acid. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
[2-(1,1,2,2,3,3,3-heptadeuteriopropyl)-6-(trifluoromethyl)-4-pyridinyl]boronic acid (CAS 2225170-66-9) is a chemical compound with the molecular formula C9H11BF3NO2 and a molecular weight of 240.04 g/mol. IUPAC name: [2-(1,1,2,2,3,3,3-heptadeuteriopropyl)-6-(trifluoromethyl)-4-pyridinyl]boronic acid. InChIKey: HMLXBPZXAPMNGZ-NCKGIQLSSA-N.
| Molecular formula | C9H11BF3NO2 |
|---|---|
| Molecular weight | 240.04 g/mol |
| IUPAC name | [2-(1,1,2,2,3,3,3-heptadeuteriopropyl)-6-(trifluoromethyl)-4-pyridinyl]boronic acid |
| InChIKey | HMLXBPZXAPMNGZ-NCKGIQLSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C1=NC(=CC(=C1)B(O)O)C(F)(F)F |
Computed by PubChem (NCBI)