Products 2225176-68-9
CAS 2225176-68-9 is the registry number for 5–(iso–Propyl)–6–trifluoromethylpyridine–3–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
[5-propan-2-yl-6-(trifluoromethyl)-3-pyridinyl]boronic acid (CAS 2225176-68-9) is a chemical compound with the molecular formula C9H11BF3NO2 and a molecular weight of 233.00 g/mol. IUPAC name: [5-propan-2-yl-6-(trifluoromethyl)-3-pyridinyl]boronic acid. InChIKey: VWZDIYNYBKTTHB-UHFFFAOYSA-N.
| Molecular formula | C9H11BF3NO2 |
|---|---|
| Molecular weight | 233.00 g/mol |
| IUPAC name | [5-propan-2-yl-6-(trifluoromethyl)-3-pyridinyl]boronic acid |
| InChIKey | VWZDIYNYBKTTHB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)C(F)(F)F)C(C)C)(O)O |
Computed by PubChem (NCBI)