CAS 1704067-32-2 appears in our catalog under these names: 4-((4-Ethylpiperazin-1-yl)sulfonyl)-3,5-dimethylphenyl)boronic acid, 95%, (4–((4–Ethylpiperazin–1–yl)sulfonyl)–3,5–dimethylphenyl)boronic acid, Boronic acid, B-[4-[(4-ethyl-1-piperazinyl)sulfonyl]-3,5-dimethylphenyl]-, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat. Available pack sizes: 250mg, 1g, 500mg.
[4-(4-ethylpiperazin-1-yl)sulfonyl-3,5-dimethylphenyl]boronic acid (CAS 1704067-32-2) is a chemical compound with the molecular formula C14H23BN2O4S and a molecular weight of 326.2 g/mol. IUPAC name: [4-(4-ethylpiperazin-1-yl)sulfonyl-3,5-dimethylphenyl]boronic acid. InChIKey: SSHDEQRNHQSAAK-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O4S |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | [4-(4-ethylpiperazin-1-yl)sulfonyl-3,5-dimethylphenyl]boronic acid |
| InChIKey | SSHDEQRNHQSAAK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)S(=O)(=O)N2CCN(CC2)CC)C)(O)O |
Computed by PubChem (NCBI)