CAS 2223044-39-9 is the registry number for tert-Butyl (4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)thiazol-2-yl)carbamate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate (CAS 2223044-39-9) is a chemical compound with the molecular formula C14H23BN2O4S and a molecular weight of 326.2 g/mol. IUPAC name: tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate. InChIKey: WTKHGPVVQNJRTL-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O4S |
|---|---|
| Molecular weight | 326.2 g/mol |
| IUPAC name | tert-butyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazol-2-yl]carbamate |
| InChIKey | WTKHGPVVQNJRTL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CSC(=N2)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)