CAS 1706429-96-0 appears in our catalog under these names: Trans-4-phenylpyrrolidin-3-ol hemioxalate, 95%, trans-4-Phenylpyrrolidin-3-ol oxalate(2:1), 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g, 10g, 100mg.
Oxalic acid;bis((3S,4R)-4-phenylpyrrolidin-3-ol) (CAS 1706429-96-0) is a chemical compound with the molecular formula C22H28N2O6 and a molecular weight of 416.5 g/mol. IUPAC name: oxalic acid;bis((3S,4R)-4-phenylpyrrolidin-3-ol). InChIKey: NOUNDKZSXRRIAB-JBWFWECBSA-N.
| Molecular formula | C22H28N2O6 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | oxalic acid;bis((3S,4R)-4-phenylpyrrolidin-3-ol) |
| InChIKey | NOUNDKZSXRRIAB-JBWFWECBSA-N |
| SMILES | C1[C@H]([C@@H](CN1)O)C2=CC=CC=C2.C1[C@H]([C@@H](CN1)O)C2=CC=CC=C2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)