Products 223472-31-9
CAS 223472-31-9 appears in our catalog under these names: ONO4817, ONO 4817, ONO 4817, MMP Inhibitor V, MMP Inhibitor V 1PC X 2MG. Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: on request, 1mg, 5mg, 2mg, 10mg, 5 mg, 1 mg, 10 mg.
N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-4-phenoxybenzamide (CAS 223472-31-9) is a chemical compound with the molecular formula C22H28N2O6 and a molecular weight of 416.5 g/mol. IUPAC name: N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-4-phenoxybenzamide. InChIKey: HDWWQELUBWGQGA-WMZOPIPTSA-N.
| Molecular formula | C22H28N2O6 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | N-[(2S,4S)-1-(ethoxymethoxy)-5-(hydroxyamino)-4-methyl-5-oxopentan-2-yl]-4-phenoxybenzamide |
| InChIKey | HDWWQELUBWGQGA-WMZOPIPTSA-N |
| SMILES | CCOCOC[C@H](C[C@H](C)C(=O)NO)NC(=O)C1=CC=C(C=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)