Products 936474-08-7
CAS 936474-08-7 appears in our catalog under these names: (R)-1-Aminoindan L-Tartrate, (R)-1-Aminoindan-d3 L-Tartrate. Offered by: Chemat Brand. Available pack sizes: on request.
Bis((1R)-2,3-dihydro-1H-inden-1-amine);(2R,3R)-2,3-dihydroxybutanedioic acid (CAS 936474-08-7) is a chemical compound with the molecular formula C22H28N2O6 and a molecular weight of 416.5 g/mol. IUPAC name: bis((1R)-2,3-dihydro-1H-inden-1-amine);(2R,3R)-2,3-dihydroxybutanedioic acid. InChIKey: MCCOKRGZMMQMIL-NFWIEASKSA-N.
| Molecular formula | C22H28N2O6 |
|---|---|
| Molecular weight | 416.5 g/mol |
| IUPAC name | bis((1R)-2,3-dihydro-1H-inden-1-amine);(2R,3R)-2,3-dihydroxybutanedioic acid |
| InChIKey | MCCOKRGZMMQMIL-NFWIEASKSA-N |
| SMILES | C1CC2=CC=CC=C2[C@@H]1N.C1CC2=CC=CC=C2[C@@H]1N.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)