Products 1706446-52-7
CAS 1706446-52-7 appears in our catalog under these names: 3,4-Dichloro-5-(trifluoromethyl)benzamide, 95%, 3,4-Dichloro-5-(trifluoromethyl)benzamide, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
3,4-dichloro-5-(trifluoromethyl)benzamide (CAS 1706446-52-7) is a chemical compound with the molecular formula C8H4Cl2F3NO and a molecular weight of 258.02 g/mol. IUPAC name: 3,4-dichloro-5-(trifluoromethyl)benzamide. InChIKey: NINFOLCHSMPYQG-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F3NO |
|---|---|
| Molecular weight | 258.02 g/mol |
| IUPAC name | 3,4-dichloro-5-(trifluoromethyl)benzamide |
| InChIKey | NINFOLCHSMPYQG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)