Products 53012-81-0
CAS 53012-81-0 appears in our catalog under these names: 2,6-Dichloro-3-(trifluoromethyl)benzamide, 95%, 2,6-Dichloro-3-(trifluoromethyl)benzamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g.
2,6-dichloro-3-(trifluoromethyl)benzamide (CAS 53012-81-0) is a chemical compound with the molecular formula C8H4Cl2F3NO and a molecular weight of 258.02 g/mol. IUPAC name: 2,6-dichloro-3-(trifluoromethyl)benzamide. InChIKey: SMZRNGXBRSLTJK-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F3NO |
|---|---|
| Molecular weight | 258.02 g/mol |
| IUPAC name | 2,6-dichloro-3-(trifluoromethyl)benzamide |
| InChIKey | SMZRNGXBRSLTJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)Cl)C(=O)N)Cl |
Computed by PubChem (NCBI)