Products 328-11-0
CAS 328-11-0 is the registry number for N-(2,5-dichlorophenyl)-2,2,2-trifluoroacetamide, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
N-(2,5-dichlorophenyl)-2,2,2-trifluoroacetamide (CAS 328-11-0) is a chemical compound with the molecular formula C8H4Cl2F3NO and a molecular weight of 258.02 g/mol. IUPAC name: N-(2,5-dichlorophenyl)-2,2,2-trifluoroacetamide. InChIKey: ZMSPWYGZEBCPEP-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl2F3NO |
|---|---|
| Molecular weight | 258.02 g/mol |
| IUPAC name | N-(2,5-dichlorophenyl)-2,2,2-trifluoroacetamide |
| InChIKey | ZMSPWYGZEBCPEP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)NC(=O)C(F)(F)F)Cl |
Computed by PubChem (NCBI)