Products 1707562-63-7
CAS 1707562-63-7 is the registry number for (4,6-Dichloroquinolin-3-yl)(4-methoxyphenyl)methanone, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(4,6-dichloroquinolin-3-yl)-(4-methoxyphenyl)methanone (CAS 1707562-63-7) is a chemical compound with the molecular formula C17H11Cl2NO2 and a molecular weight of 332.2 g/mol. IUPAC name: (4,6-dichloroquinolin-3-yl)-(4-methoxyphenyl)methanone. InChIKey: XXQQXIKPIGNTLE-UHFFFAOYSA-N.
| Molecular formula | C17H11Cl2NO2 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | (4,6-dichloroquinolin-3-yl)-(4-methoxyphenyl)methanone |
| InChIKey | XXQQXIKPIGNTLE-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C2=CN=C3C=CC(=CC3=C2Cl)Cl |
Computed by PubChem (NCBI)