Products 350997-47-6
CAS 350997-47-6 is the registry number for 2-(2,4-Dichlorophenyl)-3-methylquinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2,4-dichlorophenyl)-3-methylquinoline-4-carboxylic acid (CAS 350997-47-6) is a chemical compound with the molecular formula C17H11Cl2NO2 and a molecular weight of 332.2 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)-3-methylquinoline-4-carboxylic acid. InChIKey: CVKZCFQJEMNKAA-UHFFFAOYSA-N.
| Molecular formula | C17H11Cl2NO2 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)-3-methylquinoline-4-carboxylic acid |
| InChIKey | CVKZCFQJEMNKAA-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N=C1C3=C(C=C(C=C3)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)