Products 862677-09-6
CAS 862677-09-6 appears in our catalog under these names: 8-Chloro-2-(4-chlorophenyl)-3-methylquinoline-4-carboxylic acid, 95%, 8-Chloro-2-(4-chlorophenyl)-3-methylquinoline-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
8-chloro-2-(4-chlorophenyl)-3-methylquinoline-4-carboxylic acid (CAS 862677-09-6) is a chemical compound with the molecular formula C17H11Cl2NO2 and a molecular weight of 332.2 g/mol. IUPAC name: 8-chloro-2-(4-chlorophenyl)-3-methylquinoline-4-carboxylic acid. InChIKey: ULBAOSPTEYDMEE-UHFFFAOYSA-N.
| Molecular formula | C17H11Cl2NO2 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | 8-chloro-2-(4-chlorophenyl)-3-methylquinoline-4-carboxylic acid |
| InChIKey | ULBAOSPTEYDMEE-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C(=CC=C2)Cl)N=C1C3=CC=C(C=C3)Cl)C(=O)O |
Computed by PubChem (NCBI)