Products 1707575-91-4

CAS 1707575-91-4 is the registry number for 2-Ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

2-ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid (CAS 1707575-91-4) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 2-ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid. InChIKey: AIARXGKVMUWPBU-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9N3O2
Molecular weight191.19 g/mol
IUPAC name2-ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid
InChIKeyAIARXGKVMUWPBU-UHFFFAOYSA-N
SMILESCCC1=NN2C=C(C=NC2=C1)C(=O)O

Computed by PubChem (NCBI)