CAS 1707575-91-4 is the registry number for 2-Ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid (CAS 1707575-91-4) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: 2-ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid. InChIKey: AIARXGKVMUWPBU-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | 2-ethylpyrazolo[1,5-a]pyrimidine-6-carboxylic acid |
| InChIKey | AIARXGKVMUWPBU-UHFFFAOYSA-N |
| SMILES | CCC1=NN2C=C(C=NC2=C1)C(=O)O |
Computed by PubChem (NCBI)