CAS 1707602-26-3 appears in our catalog under these names: 7-Bromo-1,2-dihydrospiro[indole-3,4'-piperidine]-2-one hydrochloride, 95%, 7-Bromospiro(indoline-3,4'-piperidin)-2-one hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
7-bromospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride (CAS 1707602-26-3) is a chemical compound with the molecular formula C12H14BrClN2O and a molecular weight of 317.61 g/mol. IUPAC name: 7-bromospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride. InChIKey: ZPMGEKDWHGVQIL-UHFFFAOYSA-N.
| Molecular formula | C12H14BrClN2O |
|---|---|
| Molecular weight | 317.61 g/mol |
| IUPAC name | 7-bromospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride |
| InChIKey | ZPMGEKDWHGVQIL-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C(=CC=C3)Br)NC2=O.Cl |
Computed by PubChem (NCBI)