CAS 1707713-79-8 appears in our catalog under these names: 5-Bromo-1,2-dihydrospiro[indole-3,4'-piperidine]-2-one hydrochloride, 95%, 5-Bromospiro(indoline-3,4'-piperidin)-2-one hydrochloride, 98%, 5–Bromo–1,2–dihydrospiro(indole–3,4'–piperidine)–2–one hydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
5-bromospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride (CAS 1707713-79-8) is a chemical compound with the molecular formula C12H14BrClN2O and a molecular weight of 317.61 g/mol. IUPAC name: 5-bromospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride. InChIKey: YTEPNIBHZNSJML-UHFFFAOYSA-N.
| Molecular formula | C12H14BrClN2O |
|---|---|
| Molecular weight | 317.61 g/mol |
| IUPAC name | 5-bromospiro[1H-indole-3,4'-piperidine]-2-one;hydrochloride |
| InChIKey | YTEPNIBHZNSJML-UHFFFAOYSA-N |
| SMILES | C1CNCCC12C3=C(C=CC(=C3)Br)NC2=O.Cl |
Computed by PubChem (NCBI)