Products 312537-17-0
CAS 312537-17-0 is the registry number for (3-Bromo-5-chlorophenyl)(4-methylpiperazin-1-yl)methanone, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
(3-bromo-5-chlorophenyl)-(4-methylpiperazin-1-yl)methanone (CAS 312537-17-0) is a chemical compound with the molecular formula C12H14BrClN2O and a molecular weight of 317.61 g/mol. IUPAC name: (3-bromo-5-chlorophenyl)-(4-methylpiperazin-1-yl)methanone. InChIKey: FVYMIAOQEKHIRC-UHFFFAOYSA-N.
| Molecular formula | C12H14BrClN2O |
|---|---|
| Molecular weight | 317.61 g/mol |
| IUPAC name | (3-bromo-5-chlorophenyl)-(4-methylpiperazin-1-yl)methanone |
| InChIKey | FVYMIAOQEKHIRC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)C2=CC(=CC(=C2)Br)Cl |
Computed by PubChem (NCBI)