Products 170804-78-1

CAS 170804-78-1 is the registry number for 2-(4-Benzylmorpholin-2-yl)acetic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 10g, 1g.

Structural formula: {0} (CAS {1})

2-(4-benzylmorpholin-2-yl)acetic acid;hydrochloride (CAS 170804-78-1) is a chemical compound with the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. IUPAC name: 2-(4-benzylmorpholin-2-yl)acetic acid;hydrochloride. InChIKey: BEMGAPHATGFVQM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H18ClNO3
Molecular weight271.74 g/mol
IUPAC name2-(4-benzylmorpholin-2-yl)acetic acid;hydrochloride
InChIKeyBEMGAPHATGFVQM-UHFFFAOYSA-N
SMILESC1COC(CN1CC2=CC=CC=C2)CC(=O)O.Cl

Computed by PubChem (NCBI)