Products 170879-12-6
CAS 170879-12-6 appears in our catalog under these names: 2-Chloro-7-methoxy-4-phenylquinoline, 95%, 2-Chloro-7-methoxy-4-phenylquinoline. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-chloro-7-methoxy-4-phenylquinoline (CAS 170879-12-6) is a chemical compound with the molecular formula C16H12ClNO and a molecular weight of 269.72 g/mol. IUPAC name: 2-chloro-7-methoxy-4-phenylquinoline. InChIKey: MENDVTKIYKLBNT-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 2-chloro-7-methoxy-4-phenylquinoline |
| InChIKey | MENDVTKIYKLBNT-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=CC(=N2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)