CAS 90815-00-2 is the registry number for 1-(2-Chlorobenzyl)-1h-indole-3-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
1-[(2-chlorophenyl)methyl]indole-3-carbaldehyde (CAS 90815-00-2) is a chemical compound with the molecular formula C16H12ClNO and a molecular weight of 269.72 g/mol. IUPAC name: 1-[(2-chlorophenyl)methyl]indole-3-carbaldehyde. InChIKey: QMPDMKKPNRPZFV-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 1-[(2-chlorophenyl)methyl]indole-3-carbaldehyde |
| InChIKey | QMPDMKKPNRPZFV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN2C=C(C3=CC=CC=C32)C=O)Cl |
Computed by PubChem (NCBI)