Products 188674-77-3
CAS 188674-77-3 is the registry number for 3-(3-Chlorophenyl)-2-methylisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3-chlorophenyl)-2-methylisoquinolin-1-one (CAS 188674-77-3) is a chemical compound with the molecular formula C16H12ClNO and a molecular weight of 269.72 g/mol. IUPAC name: 3-(3-chlorophenyl)-2-methylisoquinolin-1-one. InChIKey: HPCQERDMGFPAAV-UHFFFAOYSA-N.
| Molecular formula | C16H12ClNO |
|---|---|
| Molecular weight | 269.72 g/mol |
| IUPAC name | 3-(3-chlorophenyl)-2-methylisoquinolin-1-one |
| InChIKey | HPCQERDMGFPAAV-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=CC=CC=C2C1=O)C3=CC(=CC=C3)Cl |
Computed by PubChem (NCBI)