CAS 1710195-44-0 appears in our catalog under these names: 1H-Thieno[3,2-c][1,2]thiazin-4(3h)-one 2,2-dioxide, 95%, 1H-Thieno(3,2-c)(1,2)thiazin-4(3H)-one 2,2-dioxide, 95%, 1H-Thieno(3,2-c)(1,2)thiazin-4(3H)-one 2,2-dioxide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 2,5g.
2,2-dioxo-1H-thieno[3,2-c]thiazin-4-one (CAS 1710195-44-0) is a chemical compound with the molecular formula C6H5NO3S2 and a molecular weight of 203.2 g/mol. IUPAC name: 2,2-dioxo-1H-thieno[3,2-c]thiazin-4-one. InChIKey: HUMUTPNXWODXDQ-UHFFFAOYSA-N.
| Molecular formula | C6H5NO3S2 |
|---|---|
| Molecular weight | 203.2 g/mol |
| IUPAC name | 2,2-dioxo-1H-thieno[3,2-c]thiazin-4-one |
| InChIKey | HUMUTPNXWODXDQ-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C=CS2)NS1(=O)=O |
Computed by PubChem (NCBI)