CAS 214692-07-6 is the registry number for 2H,3H,4H-1λâ¶-Thieno(3,2-b)(1,4)thiazine-1,1,3-trione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1-dioxo-4H-thieno[3,2-b][1,4]thiazin-3-one (CAS 214692-07-6) is a chemical compound with the molecular formula C6H5NO3S2 and a molecular weight of 203.2 g/mol. IUPAC name: 1,1-dioxo-4H-thieno[3,2-b][1,4]thiazin-3-one. InChIKey: ISVLQJUKYOVFKD-UHFFFAOYSA-N.
| Molecular formula | C6H5NO3S2 |
|---|---|
| Molecular weight | 203.2 g/mol |
| IUPAC name | 1,1-dioxo-4H-thieno[3,2-b][1,4]thiazin-3-one |
| InChIKey | ISVLQJUKYOVFKD-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(S1(=O)=O)C=CS2 |
Computed by PubChem (NCBI)