CAS 948007-59-8 appears in our catalog under these names: 2,3-Dihydro-4h-thieno[2,3-e][1,2]thiazin-4-one 1,1-dioxide, 95%, 2H-Thieno(2,3-e)(1,2)thiazin-4(3H)-one 1,1-dioxide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1,1-dioxo-2,3-dihydrothieno[2,3-e]thiazin-4-one (CAS 948007-59-8) is a chemical compound with the molecular formula C6H5NO3S2 and a molecular weight of 203.2 g/mol. IUPAC name: 1,1-dioxo-2,3-dihydrothieno[2,3-e]thiazin-4-one. InChIKey: BGSGHXGPHHVUFR-UHFFFAOYSA-N.
| Molecular formula | C6H5NO3S2 |
|---|---|
| Molecular weight | 203.2 g/mol |
| IUPAC name | 1,1-dioxo-2,3-dihydrothieno[2,3-e]thiazin-4-one |
| InChIKey | BGSGHXGPHHVUFR-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=C(C=CS2)S(=O)(=O)N1 |
Computed by PubChem (NCBI)