CAS 171284-84-7 is the registry number for (3R,7As)-3-(tert-butyl)dihydropyrrolo[1,2-c]oxazole-1,5(3h,6h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3R,7aS)-3-tert-butyl-3,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-1,5-dione (CAS 171284-84-7) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: (3R,7aS)-3-tert-butyl-3,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-1,5-dione. InChIKey: XKHXNEYLUYSDJF-IMTBSYHQSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (3R,7aS)-3-tert-butyl-3,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazole-1,5-dione |
| InChIKey | XKHXNEYLUYSDJF-IMTBSYHQSA-N |
| SMILES | CC(C)(C)[C@@H]1N2[C@@H](CCC2=O)C(=O)O1 |
Computed by PubChem (NCBI)