Products 2426657-83-0
CAS 2426657-83-0 is the registry number for (R)-tert-Butyl-3-amino-3-(4-chlorobenzyl)piperidine-1-carboxylate. Offered by: TRC. Available pack sizes: 500mg.
Tert-butyl (3R)-3-amino-3-[(4-chlorophenyl)methyl]piperidine-1-carboxylate (CAS 2426657-83-0) is a chemical compound with the molecular formula C17H25ClN2O2 and a molecular weight of 324.8 g/mol. IUPAC name: tert-butyl (3R)-3-amino-3-[(4-chlorophenyl)methyl]piperidine-1-carboxylate. InChIKey: LZQHRGZMEJGKPL-QGZVFWFLSA-N.
| Molecular formula | C17H25ClN2O2 |
|---|---|
| Molecular weight | 324.8 g/mol |
| IUPAC name | tert-butyl (3R)-3-amino-3-[(4-chlorophenyl)methyl]piperidine-1-carboxylate |
| InChIKey | LZQHRGZMEJGKPL-QGZVFWFLSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@](C1)(CC2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)