CAS 171483-23-1 appears in our catalog under these names: 2-Oxo-L-Histidine, (S)-2-Amino-3-(2-hydroxy-1H-imidazol-4-yl)propanoic acid, 98%. Offered by: Chemat Brand, AmBeed. Available pack sizes: on request, 5g, 100mg, 1g.
(2S)-2-amino-3-(2-oxo-1,3-dihydroimidazol-4-yl)propanoic acid (CAS 171483-23-1) is a chemical compound with the molecular formula C6H9N3O3 and a molecular weight of 171.15 g/mol. IUPAC name: (2S)-2-amino-3-(2-oxo-1,3-dihydroimidazol-4-yl)propanoic acid. InChIKey: KXHSJJRXZAKKRP-BYPYZUCNSA-N.
| Molecular formula | C6H9N3O3 |
|---|---|
| Molecular weight | 171.15 g/mol |
| IUPAC name | (2S)-2-amino-3-(2-oxo-1,3-dihydroimidazol-4-yl)propanoic acid |
| InChIKey | KXHSJJRXZAKKRP-BYPYZUCNSA-N |
| SMILES | C1=C(NC(=O)N1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)