Products 171596-44-4
CAS 171596-44-4 appears in our catalog under these names: Tadalafil Impurity 31, Tadalafil Impurity 22, (1R,3S)-1-(1,3-Benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido(3,4-b)indole-3-carboxylic Acid Methyl Ester. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 25mg, 50mg.
Methyl (1R,3S)-1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate (CAS 171596-44-4) is a chemical compound with the molecular formula C20H18N2O4 and a molecular weight of 350.4 g/mol. IUPAC name: methyl (1R,3S)-1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate. InChIKey: LIPVUDSNGRJSQE-MAUKXSAKSA-N.
| Molecular formula | C20H18N2O4 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | methyl (1R,3S)-1-(1,3-benzodioxol-5-yl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate |
| InChIKey | LIPVUDSNGRJSQE-MAUKXSAKSA-N |
| SMILES | COC(=O)[C@@H]1CC2=C([C@H](N1)C3=CC4=C(C=C3)OCO4)NC5=CC=CC=C25 |
Computed by PubChem (NCBI)