Products 577786-96-0
CAS 577786-96-0 is the registry number for 2-((4-(2-furylcarbonyl)piperazinyl)ethylidene)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-[1-[4-(furan-2-carbonyl)piperazin-1-yl]ethylidene]indene-1,3-dione (CAS 577786-96-0) is a chemical compound with the molecular formula C20H18N2O4 and a molecular weight of 350.4 g/mol. IUPAC name: 2-[1-[4-(furan-2-carbonyl)piperazin-1-yl]ethylidene]indene-1,3-dione. InChIKey: HUSJNAOKHXGHDC-UHFFFAOYSA-N.
| Molecular formula | C20H18N2O4 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | 2-[1-[4-(furan-2-carbonyl)piperazin-1-yl]ethylidene]indene-1,3-dione |
| InChIKey | HUSJNAOKHXGHDC-UHFFFAOYSA-N |
| SMILES | CC(=C1C(=O)C2=CC=CC=C2C1=O)N3CCN(CC3)C(=O)C4=CC=CO4 |
Computed by PubChem (NCBI)