Products 171741-93-8
CAS 171741-93-8 is the registry number for p-Coumaroyl-N-tryptophan. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoic acid (CAS 171741-93-8) is a chemical compound with the molecular formula C20H18N2O4 and a molecular weight of 350.4 g/mol. IUPAC name: (2S)-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoic acid. InChIKey: IDUPBPKKEQWWCP-HKMNZKMDSA-N.
| Molecular formula | C20H18N2O4 |
|---|---|
| Molecular weight | 350.4 g/mol |
| IUPAC name | (2S)-2-[[(E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| InChIKey | IDUPBPKKEQWWCP-HKMNZKMDSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)/C=C/C3=CC=C(C=C3)O |
Computed by PubChem (NCBI)
Synonyms:
p-coumaroyl-(l)-tryptophan, orb3179714