CAS 17177-98-9 is the registry number for 2,4-Di-tert-butyl-1-methoxybenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,4-ditert-butyl-1-methoxybenzene (CAS 17177-98-9) is a chemical compound with the molecular formula C15H24O and a molecular weight of 220.35 g/mol. IUPAC name: 2,4-ditert-butyl-1-methoxybenzene. InChIKey: VDXHGRZJSAONIB-UHFFFAOYSA-N.
| Molecular formula | C15H24O |
|---|---|
| Molecular weight | 220.35 g/mol |
| IUPAC name | 2,4-ditert-butyl-1-methoxybenzene |
| InChIKey | VDXHGRZJSAONIB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1)OC)C(C)(C)C |
Computed by PubChem (NCBI)