CAS 1718-53-2 appears in our catalog under these names: Benz(a)anthracene-d12, >95% (HPLC), Benz(a)anthracene D12, Benz(a)anthracene D12 10 µg/mL in Acetonitrile, Benz(a)anthracene D12 10 µg/mL in Cyclohexane, Benz(a)anthracene-d12, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, Dr. Ehrenstorfer, CDN, GLPBio, Sigma-Aldrich. Available pack sizes: 100mg, 1g, 25mg, 50mg, 10ml, 0,1g, 10mg, 5mg.
1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[a]anthracene (CAS 1718-53-2) is a chemical compound with the molecular formula C18H12 and a molecular weight of 240.4 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[a]anthracene. InChIKey: DXBHBZVCASKNBY-AQZSQYOVSA-N.
| Molecular formula | C18H12 |
|---|---|
| Molecular weight | 240.4 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[a]anthracene |
| InChIKey | DXBHBZVCASKNBY-AQZSQYOVSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C3=C(C4=C(C(=C(C(=C4C(=C32)[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)