Products 1795011-61-8
CAS 1795011-61-8 appears in our catalog under these names: Benzo(c)phenanthrene-d5, Benzo(c)phenanthrene–d5, Benzo[c]phenanthrene-d5. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 50mg, 25 mg, 2.5 mg.
1,2,3,4,5-pentadeuteriobenzo[c]phenanthrene (CAS 1795011-61-8) is a chemical compound with the molecular formula C18H12 and a molecular weight of 233.3 g/mol. IUPAC name: 1,2,3,4,5-pentadeuteriobenzo[c]phenanthrene. InChIKey: TUAHORSUHVUKBD-KRQPPVTFSA-N.
| Molecular formula | C18H12 |
|---|---|
| Molecular weight | 233.3 g/mol |
| IUPAC name | 1,2,3,4,5-pentadeuteriobenzo[c]phenanthrene |
| InChIKey | TUAHORSUHVUKBD-KRQPPVTFSA-N |
| SMILES | [2H]C1=CC2=C(C3=CC=CC=C3C=C2)C4=C(C(=C(C(=C14)[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)