CAS 1719-03-5 appears in our catalog under these names: Chrysene–d12, Chrysene-d12, >95% (HPLC), Chrysene D12, Chrysene D12 10 µg/mL in Acetonitrile, Chrysene D12 10 µg/mL in Cyclohexane. Offered by: GLPBio, TRC, Dr. Ehrenstorfer, CDN, Sigma-Aldrich. Available pack sizes: 5mg, 100mg, 10mg, 10ml, 1ml, 0,25g, 0,1g, 250MG.
1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriochrysene (CAS 1719-03-5) is a chemical compound with the molecular formula C18H12 and a molecular weight of 240.4 g/mol. IUPAC name: 1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriochrysene. InChIKey: WDECIBYCCFPHNR-AQZSQYOVSA-N.
| Molecular formula | C18H12 |
|---|---|
| Molecular weight | 240.4 g/mol |
| IUPAC name | 1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriochrysene |
| InChIKey | WDECIBYCCFPHNR-AQZSQYOVSA-N |
| SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C3=C2C(=C(C4=C(C(=C(C(=C43)[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)