CAS 17193-29-2 appears in our catalog under these names: tert-Butyl (S)-4,5-diamino-5-oxopentanoate 97%, H-Glu(OtBu)-NH2, 97%, 97%, (S)-tert-Butyl 4,5-diamino-5-oxopentanoate, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g.
Tert-butyl (4S)-4,5-diamino-5-oxopentanoate (CAS 17193-29-2) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl (4S)-4,5-diamino-5-oxopentanoate. InChIKey: BRWIPGSUTYVUBF-LURJTMIESA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl (4S)-4,5-diamino-5-oxopentanoate |
| InChIKey | BRWIPGSUTYVUBF-LURJTMIESA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)N)N |
Computed by PubChem (NCBI)