CAS 70701-78-9 appears in our catalog under these names: H-D-Glu(OtBu)-NH2 95%, (R)-tert-Butyl 4,5-diamino-5-oxopentanoate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g.
Tert-butyl (4R)-4,5-diamino-5-oxopentanoate (CAS 70701-78-9) is a chemical compound with the molecular formula C9H18N2O3 and a molecular weight of 202.25 g/mol. IUPAC name: tert-butyl (4R)-4,5-diamino-5-oxopentanoate. InChIKey: BRWIPGSUTYVUBF-ZCFIWIBFSA-N.
| Molecular formula | C9H18N2O3 |
|---|---|
| Molecular weight | 202.25 g/mol |
| IUPAC name | tert-butyl (4R)-4,5-diamino-5-oxopentanoate |
| InChIKey | BRWIPGSUTYVUBF-ZCFIWIBFSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@H](C(=O)N)N |
Computed by PubChem (NCBI)