Products 2766138-80-9
CAS 2766138-80-9 appears in our catalog under these names: 3-(2,4-Dioxotetrahydropyrimidin-1(2H)-yl)benzofuran-6-carboxylic acid, 98%, CRBN ligand-532. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
3-(2,4-dioxo-1,3-diazinan-1-yl)-1-benzofuran-6-carboxylic acid (CAS 2766138-80-9) is a chemical compound with the molecular formula C13H10N2O5 and a molecular weight of 274.23 g/mol. IUPAC name: 3-(2,4-dioxo-1,3-diazinan-1-yl)-1-benzofuran-6-carboxylic acid. InChIKey: VMDROROGMXLFLO-UHFFFAOYSA-N.
| Molecular formula | C13H10N2O5 |
|---|---|
| Molecular weight | 274.23 g/mol |
| IUPAC name | 3-(2,4-dioxo-1,3-diazinan-1-yl)-1-benzofuran-6-carboxylic acid |
| InChIKey | VMDROROGMXLFLO-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=COC3=C2C=CC(=C3)C(=O)O |
Computed by PubChem (NCBI)