Products 1726-77-8
CAS 1726-77-8 is the registry number for 1-(2,4-Dinitrophenyl)-2-octylidenehydrazine, 98%+, 98%+. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2,4-dinitro-N-[(E)-octylideneamino]aniline (CAS 1726-77-8) is a chemical compound with the molecular formula C14H20N4O4 and a molecular weight of 308.33 g/mol. IUPAC name: 2,4-dinitro-N-[(E)-octylideneamino]aniline. InChIKey: HIPWOUSEWCCFDN-XNTDXEJSSA-N.
| Molecular formula | C14H20N4O4 |
|---|---|
| Molecular weight | 308.33 g/mol |
| IUPAC name | 2,4-dinitro-N-[(E)-octylideneamino]aniline |
| InChIKey | HIPWOUSEWCCFDN-XNTDXEJSSA-N |
| SMILES | CCCCCCC/C=N/NC1=C(C=C(C=C1)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)