CAS 17272-83-2 appears in our catalog under these names: N1-Benzylbenzene-1,4-diamine, 97%, N1–Benzylbenzene–1,4–diamine. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 50mg.
4-N-benzylbenzene-1,4-diamine (CAS 17272-83-2) is a chemical compound with the molecular formula C13H14N2 and a molecular weight of 198.26 g/mol. IUPAC name: 4-N-benzylbenzene-1,4-diamine. InChIKey: HLFCOTXLSHLIBK-UHFFFAOYSA-N.
| Molecular formula | C13H14N2 |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 4-N-benzylbenzene-1,4-diamine |
| InChIKey | HLFCOTXLSHLIBK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)