CAS 17286-92-9 is the registry number for 2-Methyl-1,2-di-4-pyridinyl-1-propanone. Offered by: TRC. Available pack sizes: 5g.
2-methyl-1,2-dipyridin-4-ylpropan-1-one (CAS 17286-92-9) is a chemical compound with the molecular formula C14H14N2O and a molecular weight of 226.27 g/mol. IUPAC name: 2-methyl-1,2-dipyridin-4-ylpropan-1-one. InChIKey: IQHADESJQPBAES-UHFFFAOYSA-N.
| Molecular formula | C14H14N2O |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-methyl-1,2-dipyridin-4-ylpropan-1-one |
| InChIKey | IQHADESJQPBAES-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=NC=C1)C(=O)C2=CC=NC=C2 |
Computed by PubChem (NCBI)