CAS 17299-94-4 is the registry number for 1,2-Dibromo-3,4,5-trifluorobenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1,2-dibromo-3,4,5-trifluorobenzene (CAS 17299-94-4) is a chemical compound with the molecular formula C6HBr2F3 and a molecular weight of 289.87 g/mol. IUPAC name: 1,2-dibromo-3,4,5-trifluorobenzene. InChIKey: NTYZYDKXGZFYGE-UHFFFAOYSA-N.
| Molecular formula | C6HBr2F3 |
|---|---|
| Molecular weight | 289.87 g/mol |
| IUPAC name | 1,2-dibromo-3,4,5-trifluorobenzene |
| InChIKey | NTYZYDKXGZFYGE-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)Br)F)F)F |
Computed by PubChem (NCBI)