Products 811718-94-2
CAS 811718-94-2 is the registry number for 2,3-dibromo-1,4,5-trifluorobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2,3-dibromo-1,4,5-trifluorobenzene (CAS 811718-94-2) is a chemical compound with the molecular formula C6HBr2F3 and a molecular weight of 289.87 g/mol. IUPAC name: 2,3-dibromo-1,4,5-trifluorobenzene. InChIKey: XVQHPMNELKKLTH-UHFFFAOYSA-N.
| Molecular formula | C6HBr2F3 |
|---|---|
| Molecular weight | 289.87 g/mol |
| IUPAC name | 2,3-dibromo-1,4,5-trifluorobenzene |
| InChIKey | XVQHPMNELKKLTH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)Br)Br)F)F |
Computed by PubChem (NCBI)