CAS 17299-95-5 appears in our catalog under these names: 1,5-Dibromo-2,3,4-trifluorobenzene, 95%, 1,5–Dibromo–2,3,4–trifluorobenzene, 1,5-Dibromo-2,3,4-trifluorobenzene, 98%, 98%, 1,5-Dibromo-2,3,4-trifluorobenzene, 98%. Offered by: Ambeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 50g, 100g.
1,5-dibromo-2,3,4-trifluorobenzene (CAS 17299-95-5) is a chemical compound with the molecular formula C6HBr2F3 and a molecular weight of 289.87 g/mol. IUPAC name: 1,5-dibromo-2,3,4-trifluorobenzene. InChIKey: MJKUGTVPMSPTJV-UHFFFAOYSA-N.
| Molecular formula | C6HBr2F3 |
|---|---|
| Molecular weight | 289.87 g/mol |
| IUPAC name | 1,5-dibromo-2,3,4-trifluorobenzene |
| InChIKey | MJKUGTVPMSPTJV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)F)Br |
Computed by PubChem (NCBI)