CAS 1732-25-8 appears in our catalog under these names: 4-Bromo-1,2,3,6,7,8-hexahydropyrene, 95%, 4-Bromo-1,2,3,6,7,8-hexahydropyrene, 96% GC, 4–Bromo–1,2,3,6,7,8–hexahydropyrene, 4-Bromo-1,2,3,6,7,8-hexahydropyrene, >96.0%(GC), 4-Bromo-1,2,3,6,7,8-hexahydropyrene, 96%, 96%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 5g, 1g, 200mg.
4-bromo-1,2,3,6,7,8-hexahydropyrene (CAS 1732-25-8) is a chemical compound with the molecular formula C16H15Br and a molecular weight of 287.19 g/mol. IUPAC name: 4-bromo-1,2,3,6,7,8-hexahydropyrene. InChIKey: SIJTUAANVIVBQW-UHFFFAOYSA-N.
| Molecular formula | C16H15Br |
|---|---|
| Molecular weight | 287.19 g/mol |
| IUPAC name | 4-bromo-1,2,3,6,7,8-hexahydropyrene |
| InChIKey | SIJTUAANVIVBQW-UHFFFAOYSA-N |
| SMILES | C1CC2=C3C(=CC(=C4C3=C(CCC4)C=C2)Br)C1 |
Computed by PubChem (NCBI)