CAS 37503-80-3 is the registry number for (1S)-5-Bromotricyclo[8.2.2.24,7]hexadeca-4,6,10,12,13,15-hexaene 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-bromotricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene (CAS 37503-80-3) is a chemical compound with the molecular formula C16H15Br and a molecular weight of 287.19 g/mol. IUPAC name: 5-bromotricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene. InChIKey: RJOYWTPJYZNRJD-UHFFFAOYSA-N.
| Molecular formula | C16H15Br |
|---|---|
| Molecular weight | 287.19 g/mol |
| IUPAC name | 5-bromotricyclo[8.2.2.24,7]hexadeca-1(13),4,6,10(14),11,15-hexaene |
| InChIKey | RJOYWTPJYZNRJD-UHFFFAOYSA-N |
| SMILES | C1CC2=CC(=C(CCC3=CC=C1C=C3)C=C2)Br |
Computed by PubChem (NCBI)