CAS 3085564-14-0 is the registry number for 2-Bromo-5,9,9-trimethyl-9H-fluorene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-bromo-5,9,9-trimethylfluorene (CAS 3085564-14-0) is a chemical compound with the molecular formula C16H15Br and a molecular weight of 287.19 g/mol. IUPAC name: 2-bromo-5,9,9-trimethylfluorene. InChIKey: HRJXDBAXJRGXNN-UHFFFAOYSA-N.
| Molecular formula | C16H15Br |
|---|---|
| Molecular weight | 287.19 g/mol |
| IUPAC name | 2-bromo-5,9,9-trimethylfluorene |
| InChIKey | HRJXDBAXJRGXNN-UHFFFAOYSA-N |
| SMILES | CC1=C2C3=C(C=C(C=C3)Br)C(C2=CC=C1)(C)C |
Computed by PubChem (NCBI)